Dicikloverin — разлика између измена

39 бајтова уклоњено ,  пре 3 године
м
corrected template
м (уклоњена категорија Aнтиспазмодици; додана категорија Антиспазмодици помоћу…)
м (corrected template)
| smiles = O=C(OCCN(CC)CC)C1(CCCCC1)C2CCCCC2
| InChI = 1/C19H35NO2/c1-3-20(4-2)15-16-22-18(21)19(13-9-6-10-14-19)17-11-7-5-8-12-17/h17H,3-16H2,1-2H3
| InChIKey = CURUTKGFNZGFSE-UHFFFAOYAD
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C19H35NO2/c1-3-20(4-2)15-16-22-18(21)19(13-9-6-10-14-19)17-11-7-5-8-12-17/h17H,3-16H2,1-2H3
7.988.978

измена