Dicikloverin — разлика између измена

104 бајта уклоњена ,  пре 3 године
corrected template
м (corrected template)
м (corrected template)
| molecular_weight = 309,487 -{g/mol}-
| smiles = O=C(OCCN(CC)CC)C1(CCCCC1)C2CCCCC2
| InChI = 1/C19H35NO2/c1-3-20(4-2)15-16-22-18(21)19(13-9-6-10-14-19)17-11-7-5-8-12-17/h17H,3-16H2,1-2H3
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C19H35NO2/c1-3-20(4-2)15-16-22-18(21)19(13-9-6-10-14-19)17-11-7-5-8-12-17/h17H,3-16H2,1-2H3
