Dicikloverin — разлика између измена

Без промене величине ,  пре 8 година
м
нема резимеа измене
м (додана категорија Карбоксилатни естри помоћу геџета HotCat)
м
<!--Chemical data-->
| C=19 | H=35 | N=1 | O=2
| molecular_weight = 309.,487 -{g/mol}-
| smiles = O=C(OCCN(CC)CC)C1(CCCCC1)C2CCCCC2
| InChI = 1/C19H35NO2/c1-3-20(4-2)15-16-22-18(21)19(13-9-6-10-14-19)17-11-7-5-8-12-17/h17H,3-16H2,1-2H3