Oleinska kiselina — разлика између измена

м
.
м (Бот: Селим 33 међујезичких веза, које су сад на Википодацима на d:q207688)
м (.)
| OtherNames = (-{9''Z''}-)-Oktadecenoinska kiselina<br />(''Z'')-Oktadec-9-enoinska kiselina<br />''cis''-9-Octadecenoinska kiselina<br />''cis''-Δ<sup>9</sup>-Oktadecenoinska kiselina<br />18:1 cis-9
| Section1 = {{Chembox Identifiers-lat
| Abbreviations =
| SMILES = CCCCCCCC\C=C/CCCCCCCC(O)=O
| CASNo_Ref = {{cascite}}