2-Fosfoglicerinska kiselina — разлика између измена

нема резимеа измене
м (+)
|OtherNames=2PG
|Section1= {{Chembox Identifiers-lat
| Abbreviations =
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 58
| InChI = 1/C3H7O7P/c4-1-2(3(5)6)10-11(7,8)9/h2,4H,1H2,(H,5,6)(H2,7,8,9)
| CASNo_Ref = {{cascite|correct|}}
| CASNo=2553-59-5
| PubChem=59
| SMILES=C(C(C(=O)O)OP(=O)(O)O)O
}}
|Section2= {{Chembox Properties-lat
| Formula =
| MolarMass =
| Formula=C<sub>3</sub>H<sub>7</sub>O<sub>7</sub>P
| MolarMass=186,06 -{g/mol}-