Oleinska kiselina — разлика између измена

7 бајтова уклоњено ,  пре 7 година
нема резимеа измене
м (reference)
| OtherNames = (-{9''Z''}-)-Oktadecenoinska kiselina<br />(''Z'')-Oktadec-9-enoinska kiselina<br />''cis''-9-Octadecenoinska kiselina<br />''cis''-Δ<sup>9</sup>-Oktadecenoinska kiselina<br />18:1 cis-9
| Section1 = {{Chembox Identifiers-lat
| Abbreviations =
| SMILES = CCCCCCCC\C=C/CCCCCCCC(O)=O
| CASNo_Ref = {{cascite}}
| ChEMBL_Ref = {{ebicite|changedcorrect|EBI}}
| ChEMBL = 8659
| CASNo = 112-80-1
| RTECS =
}}
| Section2 = {{Chembox Properties-lat