Ramipril structure.svg

{{Drugbox | verifiedrevid = 309290459 | IUPAC_name = (2S,3aS,6aS)-1-[(2S)-2-{[(2S)-1-ethoxy-1-oxo-4- phenylbutan-2-yl]amino}propanoyl]- octahydrocyclopenta[b]pyrrole-2-carboxylic acid | image = Ramipril.svg | width = | image2 = | width2 = | CAS_number_Ref =  ДаY | CAS_number = 87333-19-5 | ChemSpiderID = 4514937 | ATC_prefix = C09 | ATC_suffix = AA05 | ATC_supplemental = | PubChem = 5362129 | IUPHAR_ligand = | ChEMBL_Ref = | ChEMBL = | DrugBank_Ref = | DrugBank = APRD00009 | C = 23 | H = 32 | N = 2 | O = 5 | molecular_weight = 416.511 g/mol | smiles = CCOC(=O)[C@H](CCc1ccccc1)N[C@H](C)C(=O)N1[C@H]2CCC[C@H]2C[C@H]1C(=O)O | StdInChI_Ref =  ДаY | StdInChI = | StdInChIKey_Ref =  ДаY | StdInChIKey = | bioavailability = 28% | protein_bound = 73% (рамиприл)
56% (рамиприлат) | metabolism = Хепатички, у рамиприлат | elimination_half-life = 2 до 4 часа | excretion = Ренално (60%) и фекално (40%) | pregnancy_category = D | legal_UK = POM | legal_US = Rx-only | routes_of_administration = Орално }} Рамиприл (лат. Tritace) је лек из групе АКЕ-инхибитора, који се користи за лечење хипертензије (високог крвног притиска) и инсуфицијенције срца.[1][2][3]


  1. ^ Keith Parker; Laurence Brunton; Goodman, Louis Sanford; Lazo, John S.; Gilman, Alfred (2006). „Chapter 30. Renin and angiotensin; Inhibitors of the renin-angiotensin system”. Goodman & Gilman's The Pharmacological Basis of Therapeutics (11. изд.). New York: McGraw-Hill. ISBN 0071422803. 
  2. ^ Група аутора (2006). Ненад Угрешић, ур. Фармакотерапијски водич 3 (PDF). Београд. ISSN 1451-4680. Архивирано из оригинала (PDF) на датум 15. 07. 2011. Приступљено 24. 05. 2010. 
  3. ^ Група аутора (2007). Љиљана Ивановић, ур. Регистар лекова 2008. Београд. 


  • Група аутора (2006). Ненад Угрешић, ур. Фармакотерапијски водич 3 (PDF). Београд. Архивирано из оригинала (PDF) на датум 15. 07. 2011. Приступљено 24. 05. 2010. 
  • Група аутора (2007). Љиљана Ивановић, ур. Регистар лекова 2008. Београд. 

Спољашње везеУреди

 Молимо Вас, обратите пажњу на важно упозорење
у вези са темама из области медицине (здравља).