Википедија

Lekozotan — разлика између измена

Интерактиван преглед историје
← Старија изменаНовија измена →
Садржај обрисан Садржај додат
ВизуелноВикитекст
м .
Autobot (разговор | доприноси)
1.572.075 измена
м ispravke; козметичке измене
Ред 8:
 
<!--Clinical data-->
| tradename =
| pregnancy_category =
| legal_status =
| routes_of_administration =
 
<!--Pharmacokinetic data-->
| bioavailability =
| metabolism =
| elimination_half-life =
| excretion =
 
<!--Identifiers-->
Ред 23:
| CAS_number = 434283-16-6
| ATC_prefix = none
| ATC_suffix =
| PubChem = 11156648
| IUPHAR_ligand =
Ред 39:
| molecular_weight = 520,021 -{g/mol}-
| smiles = c5ccc1OCCOc1c5N(CC4)CCN4C(C)CN(C(=O)c(cc2)ccc2C#N)c3ncccc3.Cl
| InChI =
| InChIKey =
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI =
Ред 47:
}}
 
'''Lekozotan''' potencijalni lek za poboljšanje kognitivnih funkcija kod obolelih od [[Алцхајмерова болест|Alchajmerove bolesti]].<ref>{{cite journal | author = H. Spreitzer | date = August 13,. 8. 2008. | title = Neue Wirkstoffe - Lecozotan | journal = Österreichische Apothekerzeitung | issue = 17/2007 | pages = 805 | language = German }}</ref><ref>[http://clinicaltrials.gov/ct2/results?intr=%22Lecozotan+SR%22 -{ClinicalTrials}-]</ref>
 
== Metod dejstva ==
Lekozotan je kompetitivni, selektivni [[antagonist (farmakologija)|antagonist]] [[5-HT1A|-{5-HT<sub>1A</sub>}-]] [[receptor (biohemija)|receptor]]<ref>{{cite journal|last=Schlechter|first=LE|date =June 10,. 6. 2005.|title=Lecotozan (SRA-333): A selective serotonin1A receptor antagonist that enhances the stimulated release of glutamate and acetylcholine in the hippocampus and promotes procognitive effects|journal=Journal of Pharmacology and Experimental Therapeutics|url=http://jpet.aspetjournals.org/cgi/content/short/jpet.105.086363v1|pmid=15951399|doi=10.1124/jpet.105.086363|volume=314|pages=1274|last2=Smith|first2=DL|last3=Rosenzweig-Lipson|first3=S|last4=Sukoff|first4=SJ|last5=Dawson|first5=LA|last6=Marquis|first6=K|last7=Jones|first7=D|last8=Piesla|first8=M|last9=Andree|first9=T|issue=3}}</ref>
koji povišava kalijumom stimulisano otpuštanje [[acetilholin]]a i [[glutamat]]a.<ref>{{cite journal
| author = Childers, WE Jr, Harrison, BL, Abou-Gharbia, MA, Raje, S, Parks, V, Pangalos, MN, Schechter, LE
Ред 67:
{{-}}
{{Serotonergici-lat}}
 
 
 
[[Категорија:5-ХТ1 антагонисти]]
Преузето из „https://sr.wikipedia.org/wiki/Lekozotan”