Dofetilid
{{Drugbox-lat | IUPAC_name = N-[4-(2-{[2-(4-metansulfonamidofenoksi)etil](metil)amino}etil)fenil]metansulfonamid | image = Dofetilide.png | width = | alt = | image2 = | width2 = | alt2 = | drug_name = Dofetilid | caption =
| tradename = Dofetilida, Tikosyn | Drugs.com = Monografija | MedlinePlus = | licence_EU = | licence_US = | DailyMedID = | pregnancy_AU = | pregnancy_US = | pregnancy_category= | legal_AU = | legal_CA = | legal_UK = | legal_US = | legal_status = | dependency_liability = | routes_of_administration = Oralno
| bioavailability = | protein_bound = | metabolism = | elimination_half-life = 10 sati | excretion =
| CAS_number_Ref = 
| CAS_number = 115256-11-6
| CAS_supplemental =
| ATCvet =
| ATC_prefix = C01
| ATC_suffix = BD04
| ATC_supplemental =
| PubChem = 71329
| PubChemSubstance = 46509127
| IUPHAR_ligand = 2604
| DrugBank_Ref =
| DrugBank = DB00204
| ChemSpiderID_Ref =
| ChemSpiderID = 64435
| UNII_Ref =
| UNII =
| KEGG_Ref =
| KEGG = C07751
| ChEBI_Ref =
| ChEBI =
| ChEMBL_Ref =
| ChEMBL = 4681
| synonyms =
|C=19 |H=27 |N=3 |O=5 |S=2
| molecular_weight = 441.565
| smiles = CN(CCOC1=CC=C(NS(C)(=O)=O)C=C1)CCC1=CC=C(NS(C)(=O)=O)C=C1
| StdInChI = 1S/C19H27N3O5S2/c1-22(13-12-16-4-6-17(7-5-16)20-28(2,23)24)14-15-27-19-10-8-18(9-11-19)21-29(3,25)26/h4-11,20-21H,12-15H2,1-3H3
| StdInChIKey_Ref =
| StdInChI_comment =
| StdInChIKey = IXTMWRCNAAVVAI-UHFFFAOYSA-N
| StdInChI_Ref =
| density =
| melting_point =
| melting_high =
| melting_notes =
| boiling_point =
| boiling_notes =
| solubility =
| specific_rotation =
| sec_combustion =
}}
Dofetilid je antiaritmični agens klase III koji je FDA odobrila za održavanje sinusnog ritma osoba sklonih formiranju atrijalne fibrilacije i tahikardiji srčanih komara.[1][2][3][4][5]
Reference
uredi- ^ Lenz TL, Hilleman DE: Dofetilide, a new class III antiarrhythmic agent. Pharmacotherapy. 2000 Jul;20(7):776-86. PMID 10907968
- ^ Lenz TL, Hilleman DE: Dofetilide: A new antiarrhythmic agent approved for conversion and/or maintenance of atrial fibrillation/atrial flutter. Drugs Today (Barc). 2000 Nov;36(11):759-71. PMID 12845335
- ^ Torp-Pedersen C, Moller M, Bloch-Thomsen PE, Kober L, Sandoe E, Egstrup K, Agner E, Carlsen J, Videbaek J, Marchant B, Camm AJ: Dofetilide in patients with congestive heart failure and left ventricular dysfunction. Danish Investigations of Arrhythmia and Mortality on Dofetilide Study Group. N Engl J Med. 1999 Sep 16;341(12):857-65. PMID 10486417
- ^ Knox C, Law V, Jewison T, Liu P, Ly S, Frolkis A, Pon A, Banco K, Mak C, Neveu V, Djoumbou Y, Eisner R, Guo AC, Wishart DS (2011). „DrugBank 3.0: a comprehensive resource for omics research on drugs”. Nucleic Acids Res. 39 (Database issue): D1035—41. PMID 21059682.
- ^ Wishart DS, Knox C, Guo AC, Cheng D, Shrivastava S, Tzur D, Gautam B, Hassanali M (Nucleic Acids Res) (2008). „DrugBank: a knowledgebase for drugs, drug actions and drug targets”. 36 (Database issue): D901—6. PMID 18048412.
Spoljašnje veze
uredi
 | Molimo Vas, obratite pažnju na važno upozorenje u vezi sa temama iz oblasti medicine (zdravlja). |
