γ-линолна киселина (гама-линолна киселина, ГЛА, гамоленска киселина) је масна киселина која је првенствено заступљена у биљним уљима. Она се продаје као прехрамбени суплемент за третирање проблема са инфламацијом и аутоимунским болестима, мада је њена ефикасност оспоравана.[3]

γ-Линолна киселина
Називи
IUPAC назив
sve-cis-6,9,12-oktadekatrienoinska kiselina
Други називи
Гама-линолна киселина, гамоленска киселина, ГЛА
Идентификација
3Д модел (Jmol)
ChEBI
ChemSpider
ECHA InfoCard 100.107.263
УНИИ
  • O=C(O)CCCC\C=C/C\C=C/C\C=C/CCCCC
Својства
C18H30O2
Моларна маса 278,44 g·mol−1
Агрегатно стање Безбојно уље
Уколико није другачије напоменуто, подаци се односе на стандардно стање материјала (на 25 °C [77 °F], 100 kPa).
ДаY верификуј (шта је ДаYНеН ?)
Референце инфокутије

Хемија уреди

ГЛА је категорисана као н−6 (такође се назива ω−6 или омега-6) масна киселина, јер је прва двострука веза на метил крају (означеном са н или ω) на шестој вези.[4] У физиолошкој литератури, ГЛА се означава као 18:3 (н−6). ГЛА је карбоксилна киселина са 18-угљеника дугим ланцом и са три цис двоструке везе. Она је изомер α-линолеинске киселине, која је полинезасићена н−3 (омега-3) масна киселина.

Референце уреди

  1. ^ Li Q, Cheng T, Wang Y, Bryant SH (2010). „PubChem as a public resource for drug discovery.”. Drug Discov Today. 15 (23-24): 1052—7. PMID 20970519. doi:10.1016/j.drudis.2010.10.003.  уреди
  2. ^ Еван Е. Болтон; Yанли Wанг; Паул А. Тхиессен; Степхен Х. Брyант (2008). „Цхаптер 12 ПубЦхем: Интегратед Платформ оф Смалл Молецулес анд Биологицал Ацтивитиес”. Аннуал Репортс ин Цомпутатионал Цхемистрy. 4: 217—241. дои:10.1016/С1574-1400(08)00012-1. 
  3. ^ Доналд Воет; Јудитх Г. Воет (2005). Биоцхемистрy (3 изд.). Wилеy. ИСБН 9780471193500. 
  4. ^ Цлаyден, Јонатхан; Греевес, Ницк; Wаррен, Стуарт; Wотхерс, Петер (2001). Органиц Цхемистрy (I изд.). Оxфорд Университy Пресс. ИСБН 978-0-19-850346-0. 

Литература уреди

Спољашње везе уреди